C24H25N3OS3 — CID 167021997
N-[4-[3-[[4-(6-methylsulfanylhex-1-ynyl)phenyl]sulfanylamino]phenyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 167021997) has the molecular formula C24H25N3OS3 and a molecular weight of 467.69 g/mol. Its IUPAC name is N-[4-[3-[[4-(6-methylsulfanylhex-1-ynyl)phenyl]sulfanylamino]phenyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[3-[[4-(6-methylsulfanylhex-1-ynyl)phenyl]sulfanylamino]phenyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 167021997 |
| Molecular Formula | C24H25N3OS3 |
| Molecular Weight | 467.69 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | N-[4-[3-[[4-(6-methylsulfanylhex-1-ynyl)phenyl]sulfanylamino]phenyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CSCCCCC#Cc1ccc(SNc2cccc(-c3csc(NC(C)=O)n3)c2)cc1 |
| InChI | InChI=1S/C24H25N3OS3/c1-18(28)25-24-26-23(17-30-24)20-9-7-10-21(16-20)27-31-22-13-11-19(12-14-22)8-5-3-4-6-15-29-2/h7,9-14,16-17,27H,3-4,6,15H2,1-2H3,(H,25,26,28) |
| InChIKey | PCQIXFCHLKDABV-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.69 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|