C19H14IN3O4S2 — CID 126543480
N-[4-[3-[[4-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]phenyl]-1,3-thiazol-2-yl]carbamoyl iodide (PubChem CID 126543480) has the molecular formula C19H14IN3O4S2 and a molecular weight of 539.38 g/mol. Its IUPAC name is N-[4-[3-[[4-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]phenyl]-1,3-thiazol-2-yl]carbamoyl iodide.
| Compound Name | N-[4-[3-[[4-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]phenyl]-1,3-thiazol-2-yl]carbamoyl iodide |
|---|---|
| PubChem CID | 126543480 |
| Molecular Formula | C19H14IN3O4S2 |
| Molecular Weight | 539.38 g/mol |
| Exact Mass | 538.95 |
| IUPAC Name | N-[4-[3-[[4-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]phenyl]-1,3-thiazol-2-yl]carbamoyl iodide |
| SMILES | O=C(I)Nc1nc(-c2cccc(NS(=O)(=O)c3ccc(C#CCO)cc3)c2)cs1 |
| InChI | InChI=1S/C19H14IN3O4S2/c20-18(25)22-19-21-17(12-28-19)14-4-1-5-15(11-14)23-29(26,27)16-8-6-13(7-9-16)3-2-10-24/h1,4-9,11-12,23-24H,10H2,(H,21,22,25) |
| InChIKey | SJMXCGPAXWZBPZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|