C18H14IN3O2S2 — CID 167021970
3-ethynyl-N-[3-[2-(iodomethylamino)-1,3-thiazol-4-yl]phenyl]benzenesulfonamide (PubChem CID 167021970) has the molecular formula C18H14IN3O2S2 and a molecular weight of 495.37 g/mol. Its IUPAC name is 3-ethynyl-N-[3-[2-(iodomethylamino)-1,3-thiazol-4-yl]phenyl]benzenesulfonamide.
| Compound Name | 3-ethynyl-N-[3-[2-(iodomethylamino)-1,3-thiazol-4-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 167021970 |
| Molecular Formula | C18H14IN3O2S2 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 494.96 |
| IUPAC Name | 3-ethynyl-N-[3-[2-(iodomethylamino)-1,3-thiazol-4-yl]phenyl]benzenesulfonamide |
| SMILES | C#Cc1cccc(S(=O)(=O)Nc2cccc(-c3csc(NCI)n3)c2)c1 |
| InChI | InChI=1S/C18H14IN3O2S2/c1-2-13-5-3-8-16(9-13)26(23,24)22-15-7-4-6-14(10-15)17-11-25-18(21-17)20-12-19/h1,3-11,22H,12H2,(H,20,21) |
| InChIKey | DQDPXJGSEQIWAO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|