C16H11BrIN3O3S2 — CID 126543438
N-[4-[3-[(3-bromophenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]carbamoyl iodide (PubChem CID 126543438) has the molecular formula C16H11BrIN3O3S2 and a molecular weight of 564.22 g/mol. Its IUPAC name is N-[4-[3-[(3-bromophenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]carbamoyl iodide.
| Compound Name | N-[4-[3-[(3-bromophenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]carbamoyl iodide |
|---|---|
| PubChem CID | 126543438 |
| Molecular Formula | C16H11BrIN3O3S2 |
| Molecular Weight | 564.22 g/mol |
| Exact Mass | 562.85 |
| IUPAC Name | N-[4-[3-[(3-bromophenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]carbamoyl iodide |
| SMILES | O=C(I)Nc1nc(-c2cccc(NS(=O)(=O)c3cccc(Br)c3)c2)cs1 |
| InChI | InChI=1S/C16H11BrIN3O3S2/c17-11-4-2-6-13(8-11)26(23,24)21-12-5-1-3-10(7-12)14-9-25-16(19-14)20-15(18)22/h1-9,21H,(H,19,20,22) |
| InChIKey | OZXYLWLVRNOKFL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.22 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|