C46H47N7O4 — CID 170705523
(3S)-3-[3-oxo-6-[4-[[1-[4-(4-phenyl-3,8-dihydro-2H-oxepino[2,3-e]indazol-5-yl)phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170705523) has the molecular formula C46H47N7O4 and a molecular weight of 761.93 g/mol. Its IUPAC name is (3S)-3-[3-oxo-6-[4-[[1-[4-(4-phenyl-3,8-dihydro-2H-oxepino[2,3-e]indazol-5-yl)phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[3-oxo-6-[4-[[1-[4-(4-phenyl-3,8-dihydro-2H-oxepino[2,3-e]indazol-5-yl)phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170705523 |
| Molecular Formula | C46H47N7O4 |
| Molecular Weight | 761.93 g/mol |
| Exact Mass | 761.37 |
| IUPAC Name | (3S)-3-[3-oxo-6-[4-[[1-[4-(4-phenyl-3,8-dihydro-2H-oxepino[2,3-e]indazol-5-yl)phenyl]piperidin-4-yl]methyl]piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](N2Cc3cc(N4CCN(CC5CCN(c6ccc(C7=C(c8ccccc8)CCOc8c7ccc7[nH]ncc87)cc6)CC5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C46H47N7O4/c54-42-15-14-41(45(55)48-42)53-29-33-26-35(10-11-37(33)46(53)56)52-23-21-50(22-24-52)28-30-16-19-51(20-17-30)34-8-6-32(7-9-34)43-36(31-4-2-1-3-5-31)18-25-57-44-38(43)12-13-40-39(44)27-47-49-40/h1-13,26-27,30,41H,14-25,28-29H2,(H,47,49)(H,48,54,55)/t41-/m0/s1 |
| InChIKey | FDADFYVPLGHTRT-RWYGWLOXSA-N |
| XLogP | 6.10 |
| TPSA | 114.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.93 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|