C14H14F4N2O — CID 170707221
2-(4-ethyl-2-fluoro-6-methoxyphenyl)-1-methyl-4-(trifluoromethyl)imidazole (PubChem CID 170707221) has the molecular formula C14H14F4N2O and a molecular weight of 302.27 g/mol. Its IUPAC name is 2-(4-ethyl-2-fluoro-6-methoxyphenyl)-1-methyl-4-(trifluoromethyl)imidazole.
| Compound Name | 2-(4-ethyl-2-fluoro-6-methoxyphenyl)-1-methyl-4-(trifluoromethyl)imidazole |
|---|---|
| PubChem CID | 170707221 |
| Molecular Formula | C14H14F4N2O |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-(4-ethyl-2-fluoro-6-methoxyphenyl)-1-methyl-4-(trifluoromethyl)imidazole |
| SMILES | CCc1cc(F)c(-c2nc(C(F)(F)F)cn2C)c(OC)c1 |
| InChI | InChI=1S/C14H14F4N2O/c1-4-8-5-9(15)12(10(6-8)21-3)13-19-11(7-20(13)2)14(16,17)18/h5-7H,4H2,1-3H3 |
| InChIKey | RLULYVKVGGNDAO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |