C14H18FNO — CID 170707360
ethane;[4-[(1E)-2-fluoro-1-(methylideneamino)buta-1,3-dienyl]phenyl]methanol (PubChem CID 170707360) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is ethane;[4-[(1E)-2-fluoro-1-(methylideneamino)buta-1,3-dienyl]phenyl]methanol.
| Compound Name | ethane;[4-[(1E)-2-fluoro-1-(methylideneamino)buta-1,3-dienyl]phenyl]methanol |
|---|---|
| PubChem CID | 170707360 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | ethane;[4-[(1E)-2-fluoro-1-(methylideneamino)buta-1,3-dienyl]phenyl]methanol |
| SMILES | C=C/C(F)=C(\N=C)c1ccc(CO)cc1.CC |
| InChI | InChI=1S/C12H12FNO.C2H6/c1-3-11(13)12(14-2)10-6-4-9(8-15)5-7-10;1-2/h3-7,15H,1-2,8H2;1-2H3/b12-11+; |
| InChIKey | ACKYKRBGGCWMPF-CALJPSDSSA-N |
| XLogP | 3.73 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|