C24H35ClN8S — CID 170709330
2-[(2S,3R)-3-[(8aS)-7,7-diethyl-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-1-[5-chloro-2-[(3-methyl-4,5-dihydro-1,2-thiazol-5-yl)amino]pyrimidin-4-yl]azetidin-2-yl]acetonitrile (PubChem CID 170709330) has the molecular formula C24H35ClN8S and a molecular weight of 503.12 g/mol. Its IUPAC name is 2-[(2S,3R)-3-[(8aS)-7,7-diethyl-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-1-[5-chloro-2-[(3-methyl-4,5-dihydro-1,2-thiazol-5-yl)amino]pyrimidin-4-yl]azetidin-2-yl]acetonitrile.
| Compound Name | 2-[(2S,3R)-3-[(8aS)-7,7-diethyl-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-1-[5-chloro-2-[(3-methyl-4,5-dihydro-1,2-thiazol-5-yl)amino]pyrimidin-4-yl]azetidin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 170709330 |
| Molecular Formula | C24H35ClN8S |
| Molecular Weight | 503.12 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 2-[(2S,3R)-3-[(8aS)-7,7-diethyl-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-1-[5-chloro-2-[(3-methyl-4,5-dihydro-1,2-thiazol-5-yl)amino]pyrimidin-4-yl]azetidin-2-yl]acetonitrile |
| SMILES | CCC1(CC)C[C@H]2CN([C@@H]3CN(c4nc(NC5CC(C)=NS5)ncc4Cl)[C@H]3CC#N)CCN2C1 |
| InChI | InChI=1S/C24H35ClN8S/c1-4-24(5-2)11-17-13-31(8-9-32(17)15-24)20-14-33(19(20)6-7-26)22-18(25)12-27-23(29-22)28-21-10-16(3)30-34-21/h12,17,19-21H,4-6,8-11,13-15H2,1-3H3,(H,27,28,29)/t17-,19-,20+,21?/m0/s1 |
| InChIKey | GNVXJEKXVGKKAY-YBVXAUJNSA-N |
| XLogP | 4.05 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.12 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|