C20H28ClN9 — CID 176723705
2-[3-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-chloropyrimidin-4-yl]azetidin-3-yl]acetonitrile (PubChem CID 176723705) has the molecular formula C20H28ClN9 and a molecular weight of 429.96 g/mol. Its IUPAC name is 2-[3-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-chloropyrimidin-4-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[3-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-chloropyrimidin-4-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 176723705 |
| Molecular Formula | C20H28ClN9 |
| Molecular Weight | 429.96 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 2-[3-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-1-[2-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]amino]-5-chloropyrimidin-4-yl]azetidin-3-yl]acetonitrile |
| SMILES | C/N=C/C(=C\N)Nc1ncc(Cl)c(N2CC(CC#N)(N3CCN4CCC[C@H]4C3)C2)n1 |
| InChI | InChI=1S/C20H28ClN9/c1-24-10-15(9-23)26-19-25-11-17(21)18(27-19)29-13-20(14-29,4-5-22)30-8-7-28-6-2-3-16(28)12-30/h9-11,16H,2-4,6-8,12-14,23H2,1H3,(H,25,26,27)/b15-9+,24-10+/t16-/m0/s1 |
| InChIKey | LHJONMINHHKPEZ-APLYBQOPSA-N |
| XLogP | 1.30 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.96 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|