C17H24ClN3O3 — CID 170709516
N-[[1-(2-chloroacetyl)azetidin-3-yl]methyl]-4-[2-(dimethylamino)ethoxy]benzamide (PubChem CID 170709516) has the molecular formula C17H24ClN3O3 and a molecular weight of 353.85 g/mol. Its IUPAC name is N-[[1-(2-chloroacetyl)azetidin-3-yl]methyl]-4-[2-(dimethylamino)ethoxy]benzamide.
| Compound Name | N-[[1-(2-chloroacetyl)azetidin-3-yl]methyl]-4-[2-(dimethylamino)ethoxy]benzamide |
|---|---|
| PubChem CID | 170709516 |
| Molecular Formula | C17H24ClN3O3 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-[[1-(2-chloroacetyl)azetidin-3-yl]methyl]-4-[2-(dimethylamino)ethoxy]benzamide |
| SMILES | CN(C)CCOc1ccc(C(=O)NCC2CN(C(=O)CCl)C2)cc1 |
| InChI | InChI=1S/C17H24ClN3O3/c1-20(2)7-8-24-15-5-3-14(4-6-15)17(23)19-10-13-11-21(12-13)16(22)9-18/h3-6,13H,7-12H2,1-2H3,(H,19,23) |
| InChIKey | ZPNXWPUAQCFXJM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|