C29H37N5O3 — CID 170710262
2-[5-[(22S)-13,19,20-trihydroxy-22-methyl-4,24-diazahexacyclo[12.7.3.01,13.03,11.05,10.016,21]tetracosa-3(11),5,7,9,16(21),17,19-heptaen-24-yl]pentyl]guanidine (PubChem CID 170710262) has the molecular formula C29H37N5O3 and a molecular weight of 503.65 g/mol. Its IUPAC name is 2-[5-[(22S)-13,19,20-trihydroxy-22-methyl-4,24-diazahexacyclo[12.7.3.01,13.03,11.05,10.016,21]tetracosa-3(11),5,7,9,16(21),17,19-heptaen-24-yl]pentyl]guanidine.
| Compound Name | 2-[5-[(22S)-13,19,20-trihydroxy-22-methyl-4,24-diazahexacyclo[12.7.3.01,13.03,11.05,10.016,21]tetracosa-3(11),5,7,9,16(21),17,19-heptaen-24-yl]pentyl]guanidine |
|---|---|
| PubChem CID | 170710262 |
| Molecular Formula | C29H37N5O3 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | 2-[5-[(22S)-13,19,20-trihydroxy-22-methyl-4,24-diazahexacyclo[12.7.3.01,13.03,11.05,10.016,21]tetracosa-3(11),5,7,9,16(21),17,19-heptaen-24-yl]pentyl]guanidine |
| SMILES | C[C@@H]1CN(CCCCCN=C(N)N)C2Cc3ccc(O)c(O)c3C13Cc1[nH]c4ccccc4c1CC23O |
| InChI | InChI=1S/C29H37N5O3/c1-17-16-34(12-6-2-5-11-32-27(30)31)24-13-18-9-10-23(35)26(36)25(18)28(17)15-22-20(14-29(24,28)37)19-7-3-4-8-21(19)33-22/h3-4,7-10,17,24,33,35-37H,2,5-6,11-16H2,1H3,(H4,30,31,32)/t17-,24?,28?,29?/m1/s1 |
| InChIKey | FWGPAUAPPUKNQE-QQNUOGENSA-N |
| XLogP | 2.67 |
| TPSA | 144.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|