C11H14O2 — CID 170712319
3-bicyclo[4.1.0]hepta-2,4-dienyl 2-methylpropanoate (PubChem CID 170712319) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 3-bicyclo[4.1.0]hepta-2,4-dienyl 2-methylpropanoate.
| Compound Name | 3-bicyclo[4.1.0]hepta-2,4-dienyl 2-methylpropanoate |
|---|---|
| PubChem CID | 170712319 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 3-bicyclo[4.1.0]hepta-2,4-dienyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1=CC2CC2C=C1 |
| InChI | InChI=1S/C11H14O2/c1-7(2)11(12)13-10-4-3-8-5-9(8)6-10/h3-4,6-9H,5H2,1-2H3 |
| InChIKey | QBTKTCNCEXFZND-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |