C17H24O — CID 143624707
ethane;3-phenoxybicyclo[4.1.0]hepta-2,4-diene (PubChem CID 143624707) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is ethane;3-phenoxybicyclo[4.1.0]hepta-2,4-diene.
| Compound Name | ethane;3-phenoxybicyclo[4.1.0]hepta-2,4-diene |
|---|---|
| PubChem CID | 143624707 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | ethane;3-phenoxybicyclo[4.1.0]hepta-2,4-diene |
| SMILES | C1=CC2CC2C=C1Oc1ccccc1.CC.CC |
| InChI | InChI=1S/C13H12O.2C2H6/c1-2-4-12(5-3-1)14-13-7-6-10-8-11(10)9-13;2*1-2/h1-7,9-11H,8H2;2*1-2H3 |
| InChIKey | FANLLAYCHPYSJJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |