C16H20O — CID 130196435
[4-(2-methylpropyl)cyclohexa-1,5-dien-1-yl]oxybenzene (PubChem CID 130196435) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is [4-(2-methylpropyl)cyclohexa-1,5-dien-1-yl]oxybenzene.
| Compound Name | [4-(2-methylpropyl)cyclohexa-1,5-dien-1-yl]oxybenzene |
|---|---|
| PubChem CID | 130196435 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | [4-(2-methylpropyl)cyclohexa-1,5-dien-1-yl]oxybenzene |
| SMILES | CC(C)CC1C=CC(Oc2ccccc2)=CC1 |
| InChI | InChI=1S/C16H20O/c1-13(2)12-14-8-10-16(11-9-14)17-15-6-4-3-5-7-15/h3-8,10-11,13-14H,9,12H2,1-2H3 |
| InChIKey | NUPNOIKEMYTRPF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |