About cyclohexa-1,5-dien-1-yloxybenzene
cyclohexa-1,5-dien-1-yloxybenzene (PubChem CID 21475481) has the molecular formula C12H12O
and a molecular weight of 172.23 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-yloxybenzene.
Molecular Properties
| Compound Name | cyclohexa-1,5-dien-1-yloxybenzene |
| PubChem CID | 21475481 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | cyclohexa-1,5-dien-1-yloxybenzene |
| SMILES | C1=CC(Oc2ccccc2)=CCC1 |
| InChI | InChI=1S/C12H12O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1,3-5,7-10H,2,6H2 |
| InChIKey | YWGXKJWTCCFCAO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohexa-1,5-dien-1-yloxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,5-dien-1-yloxybenzene?
The IUPAC name of cyclohexa-1,5-dien-1-yloxybenzene (CID 21475481) is cyclohexa-1,5-dien-1-yloxybenzene.
What is the SMILES notation for cyclohexa-1,5-dien-1-yloxybenzene?
The canonical SMILES for cyclohexa-1,5-dien-1-yloxybenzene is C1=CC(Oc2ccccc2)=CCC1.
What is the InChIKey of cyclohexa-1,5-dien-1-yloxybenzene?
The InChIKey is YWGXKJWTCCFCAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1,3-5,7-10H,2,6H2.
What are the key properties of cyclohexa-1,5-dien-1-yloxybenzene?
cyclohexa-1,5-dien-1-yloxybenzene has a molecular weight of 172.23 g/mol, XLogP of 3.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,5-dien-1-yloxybenzene is sourced from PubChem (CID 21475481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).