About dibenzo-p-dioxin
dibenzo-p-dioxin (PubChem CID 9216) has the molecular formula C12H8O2
and a molecular weight of 184.19 g/mol. Its IUPAC name is dibenzo-p-dioxin.
Molecular Properties
| Compound Name | dibenzo-p-dioxin |
| PubChem CID | 9216 |
| Molecular Formula | C12H8O2 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | dibenzo-p-dioxin |
| SMILES | c1ccc2c(c1)Oc1ccccc1O2 |
| InChI | InChI=1S/C12H8O2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-8H |
| InChIKey | NFBOHOGPQUYFRF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dibenzo-p-dioxin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzo-p-dioxin?
The IUPAC name of dibenzo-p-dioxin (CID 9216) is dibenzo-p-dioxin.
What is the SMILES notation for dibenzo-p-dioxin?
The canonical SMILES for dibenzo-p-dioxin is c1ccc2c(c1)Oc1ccccc1O2.
What is the InChIKey of dibenzo-p-dioxin?
The InChIKey is NFBOHOGPQUYFRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-8H.
What are the key properties of dibenzo-p-dioxin?
dibenzo-p-dioxin has a molecular weight of 184.19 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzo-p-dioxin is sourced from PubChem (CID 9216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).