C22H28N2O2 — CID 177034327
(2Z,4Z)-cycloocta-2,4,7-trien-1-amine;methanol;5-phenoxycyclohepta-1,4,6-trien-1-amine (PubChem CID 177034327) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is (2Z,4Z)-cycloocta-2,4,7-trien-1-amine;methanol;5-phenoxycyclohepta-1,4,6-trien-1-amine.
| Compound Name | (2Z,4Z)-cycloocta-2,4,7-trien-1-amine;methanol;5-phenoxycyclohepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 177034327 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (2Z,4Z)-cycloocta-2,4,7-trien-1-amine;methanol;5-phenoxycyclohepta-1,4,6-trien-1-amine |
| SMILES | CO.NC1=CCC=C(Oc2ccccc2)C=C1.NC1C=CC/C=C\C=C/1 |
| InChI | InChI=1S/C13H13NO.C8H11N.CH4O/c14-11-5-4-8-13(10-9-11)15-12-6-2-1-3-7-12;9-8-6-4-2-1-3-5-7-8;1-2/h1-3,5-10H,4,14H2;1-2,4-8H,3,9H2;2H,1H3/b;2-1-,6-4-,7-5?; |
| InChIKey | UYSPUGVHUSJXKW-XKPGEWSHSA-N |
| XLogP | 3.75 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|