C13H13NO — CID 123456097
4-phenoxycyclohepta-2,4-dien-1-imine (PubChem CID 123456097) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 4-phenoxycyclohepta-2,4-dien-1-imine.
| Compound Name | 4-phenoxycyclohepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123456097 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 4-phenoxycyclohepta-2,4-dien-1-imine |
| SMILES | [H]/N=C1/C=CC(Oc2ccccc2)=CCC1 |
| InChI | InChI=1S/C13H13NO/c14-11-5-4-8-13(10-9-11)15-12-6-2-1-3-7-12/h1-3,6-10,14H,4-5H2/b14-11+ |
| InChIKey | TYQKAJVYLCLLMU-SDNWHVSQSA-N |
| XLogP | 3.32 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|