C14H10F3N3O2S — CID 170712949
4-oxo-5-[4-(trifluoromethylsulfanyl)phenyl]-6,7-dihydropyrazolo[1,5-a]pyrazine-3-carbaldehyde (PubChem CID 170712949) has the molecular formula C14H10F3N3O2S and a molecular weight of 341.31 g/mol. Its IUPAC name is 4-oxo-5-[4-(trifluoromethylsulfanyl)phenyl]-6,7-dihydropyrazolo[1,5-a]pyrazine-3-carbaldehyde.
| Compound Name | 4-oxo-5-[4-(trifluoromethylsulfanyl)phenyl]-6,7-dihydropyrazolo[1,5-a]pyrazine-3-carbaldehyde |
|---|---|
| PubChem CID | 170712949 |
| Molecular Formula | C14H10F3N3O2S |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 4-oxo-5-[4-(trifluoromethylsulfanyl)phenyl]-6,7-dihydropyrazolo[1,5-a]pyrazine-3-carbaldehyde |
| SMILES | O=Cc1cnn2c1C(=O)N(c1ccc(SC(F)(F)F)cc1)CC2 |
| InChI | InChI=1S/C14H10F3N3O2S/c15-14(16,17)23-11-3-1-10(2-4-11)19-5-6-20-12(13(19)22)9(8-21)7-18-20/h1-4,7-8H,5-6H2 |
| InChIKey | AVCMGZNFCMDBOH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|