C9H7F3N4OS — CID 174495003
1-[4-(trifluoromethylsulfanyl)phenyl]-2,5-dihydrotetrazole-5-carbaldehyde (PubChem CID 174495003) has the molecular formula C9H7F3N4OS and a molecular weight of 276.24 g/mol. Its IUPAC name is 1-[4-(trifluoromethylsulfanyl)phenyl]-2,5-dihydrotetrazole-5-carbaldehyde.
| Compound Name | 1-[4-(trifluoromethylsulfanyl)phenyl]-2,5-dihydrotetrazole-5-carbaldehyde |
|---|---|
| PubChem CID | 174495003 |
| Molecular Formula | C9H7F3N4OS |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 1-[4-(trifluoromethylsulfanyl)phenyl]-2,5-dihydrotetrazole-5-carbaldehyde |
| SMILES | O=CC1N=NNN1c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7F3N4OS/c10-9(11,12)18-7-3-1-6(2-4-7)16-8(5-17)13-14-15-16/h1-5,8H,(H,13,15) |
| InChIKey | UDVBZCVSXVTEIB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|