C11H7F3N2O2S — CID 89275021
5-methylidene-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione (PubChem CID 89275021) has the molecular formula C11H7F3N2O2S and a molecular weight of 288.25 g/mol. Its IUPAC name is 5-methylidene-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-methylidene-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 89275021 |
| Molecular Formula | C11H7F3N2O2S |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 5-methylidene-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione |
| SMILES | C=C1NC(=O)N(c2ccc(SC(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C11H7F3N2O2S/c1-6-9(17)16(10(18)15-6)7-2-4-8(5-3-7)19-11(12,13)14/h2-5H,1H2,(H,15,18) |
| InChIKey | RTTLRUGBQGOEEY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|