C17H17F3N4O2S — CID 118916795
1-[2-(1H-imidazol-2-yl)ethyl]-5,5-dimethyl-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione (PubChem CID 118916795) has the molecular formula C17H17F3N4O2S and a molecular weight of 398.41 g/mol. Its IUPAC name is 1-[2-(1H-imidazol-2-yl)ethyl]-5,5-dimethyl-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 1-[2-(1H-imidazol-2-yl)ethyl]-5,5-dimethyl-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118916795 |
| Molecular Formula | C17H17F3N4O2S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 1-[2-(1H-imidazol-2-yl)ethyl]-5,5-dimethyl-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)N(c2ccc(SC(F)(F)F)cc2)C(=O)N1CCc1ncc[nH]1 |
| InChI | InChI=1S/C17H17F3N4O2S/c1-16(2)14(25)24(11-3-5-12(6-4-11)27-17(18,19)20)15(26)23(16)10-7-13-21-8-9-22-13/h3-6,8-9H,7,10H2,1-2H3,(H,21,22) |
| InChIKey | ZMUZGDHEHPEVKZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|