C18H20F3N3O2S — CID 89013519
5-methylidene-1-[2-(1-methylpyrrolidin-2-yl)ethyl]-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione (PubChem CID 89013519) has the molecular formula C18H20F3N3O2S and a molecular weight of 399.44 g/mol. Its IUPAC name is 5-methylidene-1-[2-(1-methylpyrrolidin-2-yl)ethyl]-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-methylidene-1-[2-(1-methylpyrrolidin-2-yl)ethyl]-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 89013519 |
| Molecular Formula | C18H20F3N3O2S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 5-methylidene-1-[2-(1-methylpyrrolidin-2-yl)ethyl]-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione |
| SMILES | C=C1C(=O)N(c2ccc(SC(F)(F)F)cc2)C(=O)N1CCC1CCCN1C |
| InChI | InChI=1S/C18H20F3N3O2S/c1-12-16(25)24(14-5-7-15(8-6-14)27-18(19,20)21)17(26)23(12)11-9-13-4-3-10-22(13)2/h5-8,13H,1,3-4,9-11H2,2H3 |
| InChIKey | BOMGGQGAWQZPOK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|