C24H29N3O2 — CID 170713356
ethyl 2-[(2R,3S)-3-(dibenzylamino)butan-2-yl]pyrazole-3-carboxylate (PubChem CID 170713356) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is ethyl 2-[(2R,3S)-3-(dibenzylamino)butan-2-yl]pyrazole-3-carboxylate.
| Compound Name | ethyl 2-[(2R,3S)-3-(dibenzylamino)butan-2-yl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 170713356 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | ethyl 2-[(2R,3S)-3-(dibenzylamino)butan-2-yl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1ccnn1[C@H](C)[C@H](C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H29N3O2/c1-4-29-24(28)23-15-16-25-27(23)20(3)19(2)26(17-21-11-7-5-8-12-21)18-22-13-9-6-10-14-22/h5-16,19-20H,4,17-18H2,1-3H3/t19-,20+/m0/s1 |
| InChIKey | BFKIIUUAMTYHER-VQTJNVASSA-N |
| XLogP | 4.71 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |