C24H29ClN6O2 — CID 170715420
N-[5-chloro-4-(1-methylpiperidin-4-yl)oxy-2-pyridinyl]-2-[6-(1-cyanopiperidin-4-yl)-3-pyridinyl]acetamide (PubChem CID 170715420) has the molecular formula C24H29ClN6O2 and a molecular weight of 468.99 g/mol. Its IUPAC name is N-[5-chloro-4-(1-methylpiperidin-4-yl)oxy-2-pyridinyl]-2-[6-(1-cyanopiperidin-4-yl)-3-pyridinyl]acetamide.
| Compound Name | N-[5-chloro-4-(1-methylpiperidin-4-yl)oxy-2-pyridinyl]-2-[6-(1-cyanopiperidin-4-yl)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 170715420 |
| Molecular Formula | C24H29ClN6O2 |
| Molecular Weight | 468.99 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | N-[5-chloro-4-(1-methylpiperidin-4-yl)oxy-2-pyridinyl]-2-[6-(1-cyanopiperidin-4-yl)-3-pyridinyl]acetamide |
| SMILES | CN1CCC(Oc2cc(NC(=O)Cc3ccc(C4CCN(C#N)CC4)nc3)ncc2Cl)CC1 |
| InChI | InChI=1S/C24H29ClN6O2/c1-30-8-6-19(7-9-30)33-22-13-23(28-15-20(22)25)29-24(32)12-17-2-3-21(27-14-17)18-4-10-31(16-26)11-5-18/h2-3,13-15,18-19H,4-12H2,1H3,(H,28,29,32) |
| InChIKey | LPDVGTMQEGZSKQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.99 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|