C17H22ClN3O3 — CID 170715575
N-(5-chloro-4-methoxy-2-pyridinyl)-2-(5-methoxy-6-methyl-3-pyridinyl)acetamide;ethane (PubChem CID 170715575) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is N-(5-chloro-4-methoxy-2-pyridinyl)-2-(5-methoxy-6-methyl-3-pyridinyl)acetamide;ethane.
| Compound Name | N-(5-chloro-4-methoxy-2-pyridinyl)-2-(5-methoxy-6-methyl-3-pyridinyl)acetamide;ethane |
|---|---|
| PubChem CID | 170715575 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-(5-chloro-4-methoxy-2-pyridinyl)-2-(5-methoxy-6-methyl-3-pyridinyl)acetamide;ethane |
| SMILES | CC.COc1cc(NC(=O)Cc2cnc(C)c(OC)c2)ncc1Cl |
| InChI | InChI=1S/C15H16ClN3O3.C2H6/c1-9-12(21-2)4-10(7-17-9)5-15(20)19-14-6-13(22-3)11(16)8-18-14;1-2/h4,6-8H,5H2,1-3H3,(H,18,19,20);1-2H3 |
| InChIKey | ZZEDLLNNEUAESX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |