C21H21ClN4O3 — CID 170715672
N-(5-chloro-4-methoxy-2-pyridinyl)-2-[4-(1-cyano-3,6-dihydro-2H-pyridin-5-yl)-3-methoxyphenyl]acetamide (PubChem CID 170715672) has the molecular formula C21H21ClN4O3 and a molecular weight of 412.88 g/mol. Its IUPAC name is N-(5-chloro-4-methoxy-2-pyridinyl)-2-[4-(1-cyano-3,6-dihydro-2H-pyridin-5-yl)-3-methoxyphenyl]acetamide.
| Compound Name | N-(5-chloro-4-methoxy-2-pyridinyl)-2-[4-(1-cyano-3,6-dihydro-2H-pyridin-5-yl)-3-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 170715672 |
| Molecular Formula | C21H21ClN4O3 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-(5-chloro-4-methoxy-2-pyridinyl)-2-[4-(1-cyano-3,6-dihydro-2H-pyridin-5-yl)-3-methoxyphenyl]acetamide |
| SMILES | COc1cc(NC(=O)Cc2ccc(C3=CCCN(C#N)C3)c(OC)c2)ncc1Cl |
| InChI | InChI=1S/C21H21ClN4O3/c1-28-18-8-14(5-6-16(18)15-4-3-7-26(12-15)13-23)9-21(27)25-20-10-19(29-2)17(22)11-24-20/h4-6,8,10-11H,3,7,9,12H2,1-2H3,(H,24,25,27) |
| InChIKey | NLTDJHFMBQRRGI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|