C21H23ClN6O3 — CID 170715460
[5-chloro-2-[[2-[6-(1-cyanopiperidin-4-yl)-3-pyridinyl]acetyl]amino]-4-pyridinyl] N,N-dimethylcarbamate (PubChem CID 170715460) has the molecular formula C21H23ClN6O3 and a molecular weight of 442.91 g/mol. Its IUPAC name is [5-chloro-2-[[2-[6-(1-cyanopiperidin-4-yl)-3-pyridinyl]acetyl]amino]-4-pyridinyl] N,N-dimethylcarbamate.
| Compound Name | [5-chloro-2-[[2-[6-(1-cyanopiperidin-4-yl)-3-pyridinyl]acetyl]amino]-4-pyridinyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 170715460 |
| Molecular Formula | C21H23ClN6O3 |
| Molecular Weight | 442.91 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | [5-chloro-2-[[2-[6-(1-cyanopiperidin-4-yl)-3-pyridinyl]acetyl]amino]-4-pyridinyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1cc(NC(=O)Cc2ccc(C3CCN(C#N)CC3)nc2)ncc1Cl |
| InChI | InChI=1S/C21H23ClN6O3/c1-27(2)21(30)31-18-10-19(25-12-16(18)22)26-20(29)9-14-3-4-17(24-11-14)15-5-7-28(13-23)8-6-15/h3-4,10-12,15H,5-9H2,1-2H3,(H,25,26,29) |
| InChIKey | WRXQWMBMQCMRTK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.91 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|