C12H22N2O4 — CID 170716042
2-[acetyl-(1-formylpiperidin-4-yl)amino]acetic acid;ethane (PubChem CID 170716042) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[acetyl-(1-formylpiperidin-4-yl)amino]acetic acid;ethane.
| Compound Name | 2-[acetyl-(1-formylpiperidin-4-yl)amino]acetic acid;ethane |
|---|---|
| PubChem CID | 170716042 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 2-[acetyl-(1-formylpiperidin-4-yl)amino]acetic acid;ethane |
| SMILES | CC.CC(=O)N(CC(=O)O)C1CCN(C=O)CC1 |
| InChI | InChI=1S/C10H16N2O4.C2H6/c1-8(14)12(6-10(15)16)9-2-4-11(7-13)5-3-9;1-2/h7,9H,2-6H2,1H3,(H,15,16);1-2H3 |
| InChIKey | CFNBZKRHCXVSHY-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|