C23H24FN5O3S — CID 170717564
4-[4-(1-amino-2-methoxyethyl)-2-fluorophenyl]-N-(oxan-4-yl)-7-thia-2,5,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),3,5,8,10-pentaene-10-carboxamide (PubChem CID 170717564) has the molecular formula C23H24FN5O3S and a molecular weight of 469.54 g/mol. Its IUPAC name is 4-[4-(1-amino-2-methoxyethyl)-2-fluorophenyl]-N-(oxan-4-yl)-7-thia-2,5,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),3,5,8,10-pentaene-10-carboxamide.
| Compound Name | 4-[4-(1-amino-2-methoxyethyl)-2-fluorophenyl]-N-(oxan-4-yl)-7-thia-2,5,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),3,5,8,10-pentaene-10-carboxamide |
|---|---|
| PubChem CID | 170717564 |
| Molecular Formula | C23H24FN5O3S |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 4-[4-(1-amino-2-methoxyethyl)-2-fluorophenyl]-N-(oxan-4-yl)-7-thia-2,5,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),3,5,8,10-pentaene-10-carboxamide |
| SMILES | COCC(N)c1ccc(-c2cn3c(n2)sc2cc(C(=O)NC4CCOCC4)ncc23)c(F)c1 |
| InChI | InChI=1S/C23H24FN5O3S/c1-31-12-17(25)13-2-3-15(16(24)8-13)19-11-29-20-10-26-18(9-21(20)33-23(29)28-19)22(30)27-14-4-6-32-7-5-14/h2-3,8-11,14,17H,4-7,12,25H2,1H3,(H,27,30) |
| InChIKey | OKZOCGDVLWRZNO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |