C21H21ClFN5O2S — CID 166039236
N-(3-aminopropyl)-2-[2-fluoro-4-(methylcarbamoyl)phenyl]imidazo[2,1-b][1,3]benzothiazole-6-carboxamide;hydrochloride (PubChem CID 166039236) has the molecular formula C21H21ClFN5O2S and a molecular weight of 461.95 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-[2-fluoro-4-(methylcarbamoyl)phenyl]imidazo[2,1-b][1,3]benzothiazole-6-carboxamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-2-[2-fluoro-4-(methylcarbamoyl)phenyl]imidazo[2,1-b][1,3]benzothiazole-6-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 166039236 |
| Molecular Formula | C21H21ClFN5O2S |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | N-(3-aminopropyl)-2-[2-fluoro-4-(methylcarbamoyl)phenyl]imidazo[2,1-b][1,3]benzothiazole-6-carboxamide;hydrochloride |
| SMILES | CNC(=O)c1ccc(-c2cn3c(n2)sc2cc(C(=O)NCCCN)ccc23)c(F)c1.Cl |
| InChI | InChI=1S/C21H20FN5O2S.ClH/c1-24-19(28)12-3-5-14(15(22)9-12)16-11-27-17-6-4-13(20(29)25-8-2-7-23)10-18(17)30-21(27)26-16;/h3-6,9-11H,2,7-8,23H2,1H3,(H,24,28)(H,25,29);1H |
| InChIKey | DSCHDQQSIXTOIV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|