C23H25FN4OS — CID 164571962
N-[3-(diethylamino)propyl]-2-(3-fluorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide (PubChem CID 164571962) has the molecular formula C23H25FN4OS and a molecular weight of 424.55 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2-(3-fluorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-2-(3-fluorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 164571962 |
| Molecular Formula | C23H25FN4OS |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2-(3-fluorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1ccc2c(c1)sc1nc(-c3cccc(F)c3)cn12 |
| InChI | InChI=1S/C23H25FN4OS/c1-3-27(4-2)12-6-11-25-22(29)17-9-10-20-21(14-17)30-23-26-19(15-28(20)23)16-7-5-8-18(24)13-16/h5,7-10,13-15H,3-4,6,11-12H2,1-2H3,(H,25,29) |
| InChIKey | RPXLCNQGOZQIRP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|