C21H29N5O2S — CID 164571942
N-[3-(diethylamino)propyl]-2-morpholin-4-ylimidazo[2,1-b][1,3]benzothiazole-6-carboxamide (PubChem CID 164571942) has the molecular formula C21H29N5O2S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2-morpholin-4-ylimidazo[2,1-b][1,3]benzothiazole-6-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-2-morpholin-4-ylimidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 164571942 |
| Molecular Formula | C21H29N5O2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2-morpholin-4-ylimidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1ccc2c(c1)sc1nc(N3CCOCC3)cn12 |
| InChI | InChI=1S/C21H29N5O2S/c1-3-24(4-2)9-5-8-22-20(27)16-6-7-17-18(14-16)29-21-23-19(15-26(17)21)25-10-12-28-13-11-25/h6-7,14-15H,3-5,8-13H2,1-2H3,(H,22,27) |
| InChIKey | FPGXSTDMENTQCM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|