C28H34N4O2S — CID 164571921
N-[3-(diethylamino)propyl]-2-[4-(oxan-4-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole-6-carboxamide (PubChem CID 164571921) has the molecular formula C28H34N4O2S and a molecular weight of 490.67 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2-[4-(oxan-4-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole-6-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-2-[4-(oxan-4-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 164571921 |
| Molecular Formula | C28H34N4O2S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2-[4-(oxan-4-yl)phenyl]imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1ccc2c(c1)sc1nc(-c3ccc(C4CCOCC4)cc3)cn12 |
| InChI | InChI=1S/C28H34N4O2S/c1-3-31(4-2)15-5-14-29-27(33)23-10-11-25-26(18-23)35-28-30-24(19-32(25)28)22-8-6-20(7-9-22)21-12-16-34-17-13-21/h6-11,18-19,21H,3-5,12-17H2,1-2H3,(H,29,33) |
| InChIKey | WPSYSUBYDADGGB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|