C28H37N5O2S — CID 167229975
N',N'-diethyl-N-[3-[2-[4-[(2-methoxyethylamino)methyl]phenyl]imidazo[2,1-b][1,3]benzothiazol-6-yl]oxiran-2-yl]propane-1,3-diamine (PubChem CID 167229975) has the molecular formula C28H37N5O2S and a molecular weight of 507.70 g/mol. Its IUPAC name is N',N'-diethyl-N-[3-[2-[4-[(2-methoxyethylamino)methyl]phenyl]imidazo[2,1-b][1,3]benzothiazol-6-yl]oxiran-2-yl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[3-[2-[4-[(2-methoxyethylamino)methyl]phenyl]imidazo[2,1-b][1,3]benzothiazol-6-yl]oxiran-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 167229975 |
| Molecular Formula | C28H37N5O2S |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | N',N'-diethyl-N-[3-[2-[4-[(2-methoxyethylamino)methyl]phenyl]imidazo[2,1-b][1,3]benzothiazol-6-yl]oxiran-2-yl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNC1OC1c1ccc2c(c1)sc1nc(-c3ccc(CNCCOC)cc3)cn12 |
| InChI | InChI=1S/C28H37N5O2S/c1-4-32(5-2)15-6-13-30-27-26(35-27)22-11-12-24-25(17-22)36-28-31-23(19-33(24)28)21-9-7-20(8-10-21)18-29-14-16-34-3/h7-12,17,19,26-27,29-30H,4-6,13-16,18H2,1-3H3 |
| InChIKey | MSUBGKTZRSJDRQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 66.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|