C31H37FN4O2S — CID 167229820
[1-cyclopropyl-2-[4-[(2R)-oxolan-2-yl]phenyl]imidazo[2,1-b][1,3]benzothiazol-6-yl]-[3-(4-fluoropiperidin-1-yl)propylamino]methanol (PubChem CID 167229820) has the molecular formula C31H37FN4O2S and a molecular weight of 548.73 g/mol. Its IUPAC name is [1-cyclopropyl-2-[4-[(2R)-oxolan-2-yl]phenyl]imidazo[2,1-b][1,3]benzothiazol-6-yl]-[3-(4-fluoropiperidin-1-yl)propylamino]methanol.
| Compound Name | [1-cyclopropyl-2-[4-[(2R)-oxolan-2-yl]phenyl]imidazo[2,1-b][1,3]benzothiazol-6-yl]-[3-(4-fluoropiperidin-1-yl)propylamino]methanol |
|---|---|
| PubChem CID | 167229820 |
| Molecular Formula | C31H37FN4O2S |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | [1-cyclopropyl-2-[4-[(2R)-oxolan-2-yl]phenyl]imidazo[2,1-b][1,3]benzothiazol-6-yl]-[3-(4-fluoropiperidin-1-yl)propylamino]methanol |
| SMILES | OC(NCCCN1CCC(F)CC1)c1ccc2c(c1)sc1nc(-c3ccc([C@H]4CCCO4)cc3)c(C3CC3)n12 |
| InChI | InChI=1S/C31H37FN4O2S/c32-24-12-16-35(17-13-24)15-2-14-33-30(37)23-10-11-25-27(19-23)39-31-34-28(29(36(25)31)22-8-9-22)21-6-4-20(5-7-21)26-3-1-18-38-26/h4-7,10-11,19,22,24,26,30,33,37H,1-3,8-9,12-18H2/t26-,30?/m1/s1 |
| InChIKey | JYSTXCJAIBNJSR-FIQOPJFZSA-N |
| XLogP | 6.35 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|