C22H22FN3OS2 — CID 22523788
2-(4-fluorophenyl)-N-(3-propylsulfanylpropyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide (PubChem CID 22523788) has the molecular formula C22H22FN3OS2 and a molecular weight of 427.57 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(3-propylsulfanylpropyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-(3-propylsulfanylpropyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 22523788 |
| Molecular Formula | C22H22FN3OS2 |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(3-propylsulfanylpropyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
| SMILES | CCCSCCCNC(=O)c1ccc2c(c1)sc1nc(-c3ccc(F)cc3)cn12 |
| InChI | InChI=1S/C22H22FN3OS2/c1-2-11-28-12-3-10-24-21(27)16-6-9-19-20(13-16)29-22-25-18(14-26(19)22)15-4-7-17(23)8-5-15/h4-9,13-14H,2-3,10-12H2,1H3,(H,24,27) |
| InChIKey | YEHWAYXRNDTYKF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|