C23H25N5OS — CID 164571983
N-(3-piperidin-1-ylpropyl)-2-pyridin-4-ylimidazo[2,1-b][1,3]benzothiazole-6-carboxamide (PubChem CID 164571983) has the molecular formula C23H25N5OS and a molecular weight of 419.55 g/mol. Its IUPAC name is N-(3-piperidin-1-ylpropyl)-2-pyridin-4-ylimidazo[2,1-b][1,3]benzothiazole-6-carboxamide.
| Compound Name | N-(3-piperidin-1-ylpropyl)-2-pyridin-4-ylimidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 164571983 |
| Molecular Formula | C23H25N5OS |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-(3-piperidin-1-ylpropyl)-2-pyridin-4-ylimidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
| SMILES | O=C(NCCCN1CCCCC1)c1ccc2c(c1)sc1nc(-c3ccncc3)cn12 |
| InChI | InChI=1S/C23H25N5OS/c29-22(25-9-4-14-27-12-2-1-3-13-27)18-5-6-20-21(15-18)30-23-26-19(16-28(20)23)17-7-10-24-11-8-17/h5-8,10-11,15-16H,1-4,9,12-14H2,(H,25,29) |
| InChIKey | HEQOUCDUBMXHSL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|