C24H25FN4OS — CID 164571912
2-(2-fluorophenyl)-N-(3-piperidin-1-ylpropyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide (PubChem CID 164571912) has the molecular formula C24H25FN4OS and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-(3-piperidin-1-ylpropyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide.
| Compound Name | 2-(2-fluorophenyl)-N-(3-piperidin-1-ylpropyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 164571912 |
| Molecular Formula | C24H25FN4OS |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-(2-fluorophenyl)-N-(3-piperidin-1-ylpropyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
| SMILES | O=C(NCCCN1CCCCC1)c1ccc2c(c1)sc1nc(-c3ccccc3F)cn12 |
| InChI | InChI=1S/C24H25FN4OS/c25-19-8-3-2-7-18(19)20-16-29-21-10-9-17(15-22(21)31-24(29)27-20)23(30)26-11-6-14-28-12-4-1-5-13-28/h2-3,7-10,15-16H,1,4-6,11-14H2,(H,26,30) |
| InChIKey | GVXDZXIDGPNCBH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|