C24H26N4OS2 — CID 170717687
2-(3-methylphenyl)-N-(3-thiomorpholin-4-ylpropyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide (PubChem CID 170717687) has the molecular formula C24H26N4OS2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 2-(3-methylphenyl)-N-(3-thiomorpholin-4-ylpropyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide.
| Compound Name | 2-(3-methylphenyl)-N-(3-thiomorpholin-4-ylpropyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 170717687 |
| Molecular Formula | C24H26N4OS2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 2-(3-methylphenyl)-N-(3-thiomorpholin-4-ylpropyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
| SMILES | Cc1cccc(-c2cn3c(n2)sc2cc(C(=O)NCCCN4CCSCC4)ccc23)c1 |
| InChI | InChI=1S/C24H26N4OS2/c1-17-4-2-5-18(14-17)20-16-28-21-7-6-19(15-22(21)31-24(28)26-20)23(29)25-8-3-9-27-10-12-30-13-11-27/h2,4-7,14-16H,3,8-13H2,1H3,(H,25,29) |
| InChIKey | KLFYTMJUINNBEF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|