C23H24N4O3S — CID 175792726
formic acid;N-[3-(methylamino)cyclobutyl]-2-(3-methylphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide (PubChem CID 175792726) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is formic acid;N-[3-(methylamino)cyclobutyl]-2-(3-methylphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide.
| Compound Name | formic acid;N-[3-(methylamino)cyclobutyl]-2-(3-methylphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 175792726 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | formic acid;N-[3-(methylamino)cyclobutyl]-2-(3-methylphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
| SMILES | CNC1CC(NC(=O)c2ccc3c(c2)sc2nc(-c4cccc(C)c4)cn23)C1.O=CO |
| InChI | InChI=1S/C22H22N4OS.CH2O2/c1-13-4-3-5-14(8-13)18-12-26-19-7-6-15(9-20(19)28-22(26)25-18)21(27)24-17-10-16(11-17)23-2;2-1-3/h3-9,12,16-17,23H,10-11H2,1-2H3,(H,24,27);1H,(H,2,3) |
| InChIKey | UIBTZBNFGIQEJN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|