C26H29FN4O2S — CID 167633099
4-[6-[5-(diethylamino)pentanoyl]imidazo[2,1-b][1,3]benzothiazol-2-yl]-3-fluoro-N-methylbenzamide (PubChem CID 167633099) has the molecular formula C26H29FN4O2S and a molecular weight of 480.61 g/mol. Its IUPAC name is 4-[6-[5-(diethylamino)pentanoyl]imidazo[2,1-b][1,3]benzothiazol-2-yl]-3-fluoro-N-methylbenzamide.
| Compound Name | 4-[6-[5-(diethylamino)pentanoyl]imidazo[2,1-b][1,3]benzothiazol-2-yl]-3-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 167633099 |
| Molecular Formula | C26H29FN4O2S |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 4-[6-[5-(diethylamino)pentanoyl]imidazo[2,1-b][1,3]benzothiazol-2-yl]-3-fluoro-N-methylbenzamide |
| SMILES | CCN(CC)CCCCC(=O)c1ccc2c(c1)sc1nc(-c3ccc(C(=O)NC)cc3F)cn12 |
| InChI | InChI=1S/C26H29FN4O2S/c1-4-30(5-2)13-7-6-8-23(32)17-10-12-22-24(15-17)34-26-29-21(16-31(22)26)19-11-9-18(14-20(19)27)25(33)28-3/h9-12,14-16H,4-8,13H2,1-3H3,(H,28,33) |
| InChIKey | OBYFFLPKVJAYOD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|