C25H28FN3OS — CID 167637521
5-(diethylamino)-1-[2-(2-fluoro-5-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]pentan-1-one (PubChem CID 167637521) has the molecular formula C25H28FN3OS and a molecular weight of 437.58 g/mol. Its IUPAC name is 5-(diethylamino)-1-[2-(2-fluoro-5-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]pentan-1-one.
| Compound Name | 5-(diethylamino)-1-[2-(2-fluoro-5-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]pentan-1-one |
|---|---|
| PubChem CID | 167637521 |
| Molecular Formula | C25H28FN3OS |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 5-(diethylamino)-1-[2-(2-fluoro-5-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]pentan-1-one |
| SMILES | CCN(CC)CCCCC(=O)c1ccc2c(c1)sc1nc(-c3cc(C)ccc3F)cn12 |
| InChI | InChI=1S/C25H28FN3OS/c1-4-28(5-2)13-7-6-8-23(30)18-10-12-22-24(15-18)31-25-27-21(16-29(22)25)19-14-17(3)9-11-20(19)26/h9-12,14-16H,4-8,13H2,1-3H3 |
| InChIKey | ORMZVYLIZDVGAN-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|