C23H25FN4OS — CID 167564657
5-(diethylamino)-1-[2-(3-fluoro-4-pyridinyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]pentan-1-one (PubChem CID 167564657) has the molecular formula C23H25FN4OS and a molecular weight of 424.55 g/mol. Its IUPAC name is 5-(diethylamino)-1-[2-(3-fluoro-4-pyridinyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]pentan-1-one.
| Compound Name | 5-(diethylamino)-1-[2-(3-fluoro-4-pyridinyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]pentan-1-one |
|---|---|
| PubChem CID | 167564657 |
| Molecular Formula | C23H25FN4OS |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 5-(diethylamino)-1-[2-(3-fluoro-4-pyridinyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]pentan-1-one |
| SMILES | CCN(CC)CCCCC(=O)c1ccc2c(c1)sc1nc(-c3ccncc3F)cn12 |
| InChI | InChI=1S/C23H25FN4OS/c1-3-27(4-2)12-6-5-7-21(29)16-8-9-20-22(13-16)30-23-26-19(15-28(20)23)17-10-11-25-14-18(17)24/h8-11,13-15H,3-7,12H2,1-2H3 |
| InChIKey | FCSYBFJPGBBJJO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|