C28H34N4OS — CID 167554280
5-(diethylamino)-1-[2-(3-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]pentan-1-one (PubChem CID 167554280) has the molecular formula C28H34N4OS and a molecular weight of 474.67 g/mol. Its IUPAC name is 5-(diethylamino)-1-[2-(3-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]pentan-1-one.
| Compound Name | 5-(diethylamino)-1-[2-(3-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]pentan-1-one |
|---|---|
| PubChem CID | 167554280 |
| Molecular Formula | C28H34N4OS |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 5-(diethylamino)-1-[2-(3-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]pentan-1-one |
| SMILES | CCN(CC)CCCCC(=O)c1ccc2c(c1)sc1nc(-c3cccc(N4CCCC4)c3)cn12 |
| InChI | InChI=1S/C28H34N4OS/c1-3-30(4-2)15-6-5-12-26(33)22-13-14-25-27(19-22)34-28-29-24(20-32(25)28)21-10-9-11-23(18-21)31-16-7-8-17-31/h9-11,13-14,18-20H,3-8,12,15-17H2,1-2H3 |
| InChIKey | CUPSBMCPSIRFMH-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|