C18H20BrN3O3S — CID 170717815
1-[[4-(bromomethyl)furan-2-yl]sulfonimidoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 170717815) has the molecular formula C18H20BrN3O3S and a molecular weight of 438.35 g/mol. Its IUPAC name is 1-[[4-(bromomethyl)furan-2-yl]sulfonimidoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[[4-(bromomethyl)furan-2-yl]sulfonimidoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 170717815 |
| Molecular Formula | C18H20BrN3O3S |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 1-[[4-(bromomethyl)furan-2-yl]sulfonimidoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | [H]N=S(=O)(NC(=O)Nc1c2c(cc3c1CCC3)CCC2)c1cc(CBr)co1 |
| InChI | InChI=1S/C18H20BrN3O3S/c19-9-11-7-16(25-10-11)26(20,24)22-18(23)21-17-14-5-1-3-12(14)8-13-4-2-6-15(13)17/h7-8,10H,1-6,9H2,(H3,20,21,22,23,24) |
| InChIKey | BSNAQMOQCPLQJI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|