C12H19F2NO2 — CID 170720876
7-butyl-8,8-difluoro-1-oxa-3-azaspiro[4.5]decan-2-one (PubChem CID 170720876) has the molecular formula C12H19F2NO2 and a molecular weight of 247.28 g/mol. Its IUPAC name is 7-butyl-8,8-difluoro-1-oxa-3-azaspiro[4.5]decan-2-one.
| Compound Name | 7-butyl-8,8-difluoro-1-oxa-3-azaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 170720876 |
| Molecular Formula | C12H19F2NO2 |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 7-butyl-8,8-difluoro-1-oxa-3-azaspiro[4.5]decan-2-one |
| SMILES | CCCCC1CC2(CCC1(F)F)CNC(=O)O2 |
| InChI | InChI=1S/C12H19F2NO2/c1-2-3-4-9-7-11(5-6-12(9,13)14)8-15-10(16)17-11/h9H,2-8H2,1H3,(H,15,16) |
| InChIKey | FAEUPMVYFKLMHV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |