C22H17F26NO2 — CID 11686508
(4S)-4-propan-2-yl-5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-oxazolidin-2-one (PubChem CID 11686508) has the molecular formula C22H17F26NO2 and a molecular weight of 821.33 g/mol. Its IUPAC name is (4S)-4-propan-2-yl-5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-propan-2-yl-5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11686508 |
| Molecular Formula | C22H17F26NO2 |
| Molecular Weight | 821.33 g/mol |
| Exact Mass | 821.08 |
| IUPAC Name | (4S)-4-propan-2-yl-5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@@H]1NC(=O)OC1(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H17F26NO2/c1-7(2)8-10(51-9(50)49-8,3-5-11(23,24)13(27,28)15(31,32)17(35,36)19(39,40)21(43,44)45)4-6-12(25,26)14(29,30)16(33,34)18(37,38)20(41,42)22(46,47)48/h7-8H,3-6H2,1-2H3,(H,49,50)/t8-/m0/s1 |
| InChIKey | LMCACJDYTYCWFJ-QMMMGPOBSA-N |
| XLogP | 10.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.33 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|