C26H27F26NO3 — CID 11498882
tert-butyl N-[(3S)-7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-4-hydroxy-2-methyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)dodecan-3-yl]carbamate (PubChem CID 11498882) has the molecular formula C26H27F26NO3 and a molecular weight of 895.45 g/mol. Its IUPAC name is tert-butyl N-[(3S)-7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-4-hydroxy-2-methyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)dodecan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-4-hydroxy-2-methyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)dodecan-3-yl]carbamate |
|---|---|
| PubChem CID | 11498882 |
| Molecular Formula | C26H27F26NO3 |
| Molecular Weight | 895.45 g/mol |
| Exact Mass | 895.16 |
| IUPAC Name | tert-butyl N-[(3S)-7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-4-hydroxy-2-methyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)dodecan-3-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(O)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C26H27F26NO3/c1-10(2)11(53-12(54)56-13(3,4)5)14(55,6-8-15(27,28)17(31,32)19(35,36)21(39,40)23(43,44)25(47,48)49)7-9-16(29,30)18(33,34)20(37,38)22(41,42)24(45,46)26(50,51)52/h10-11,55H,6-9H2,1-5H3,(H,53,54)/t11-/m0/s1 |
| InChIKey | RUQFEPYSEDDVIS-NSHDSACASA-N |
| XLogP | 11.30 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.45 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|