C14H26F3NO3 — CID 91045138
tert-butyl N-[7-hydroxy-2-methyl-4-(trifluoromethyl)heptan-3-yl]carbamate (PubChem CID 91045138) has the molecular formula C14H26F3NO3 and a molecular weight of 313.36 g/mol. Its IUPAC name is tert-butyl N-[7-hydroxy-2-methyl-4-(trifluoromethyl)heptan-3-yl]carbamate.
| Compound Name | tert-butyl N-[7-hydroxy-2-methyl-4-(trifluoromethyl)heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 91045138 |
| Molecular Formula | C14H26F3NO3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | tert-butyl N-[7-hydroxy-2-methyl-4-(trifluoromethyl)heptan-3-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(CCCO)C(F)(F)F |
| InChI | InChI=1S/C14H26F3NO3/c1-9(2)11(18-12(20)21-13(3,4)5)10(7-6-8-19)14(15,16)17/h9-11,19H,6-8H2,1-5H3,(H,18,20) |
| InChIKey | DNPZSDWATKIDAN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |